C32H49NO4Si — CID 91745467
5-(cyclopropylmethyl)-16-(3,3-dimethyl-2-trimethylsilyloxybutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol (PubChem CID 91745467) has the molecular formula C32H49NO4Si and a molecular weight of 539.83 g/mol. Its IUPAC name is 5-(cyclopropylmethyl)-16-(3,3-dimethyl-2-trimethylsilyloxybutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol.
| Compound Name | 5-(cyclopropylmethyl)-16-(3,3-dimethyl-2-trimethylsilyloxybutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
|---|---|
| PubChem CID | 91745467 |
| Molecular Formula | C32H49NO4Si |
| Molecular Weight | 539.83 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | 5-(cyclopropylmethyl)-16-(3,3-dimethyl-2-trimethylsilyloxybutan-2-yl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-trien-11-ol |
| SMILES | COC12CCC3(CC1C(C)(O[Si](C)(C)C)C(C)(C)C)C1Cc4ccc(O)c5c4C3(CCN1CC1CC1)C2O5 |
| InChI | InChI=1S/C32H49NO4Si/c1-28(2,3)29(4,37-38(6,7)8)23-18-30-13-14-32(23,35-5)27-31(30)15-16-33(19-20-9-10-20)24(30)17-21-11-12-22(34)26(36-27)25(21)31/h11-12,20,23-24,27,34H,9-10,13-19H2,1-8H3 |
| InChIKey | LBXMBXKWTGFREB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.83 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|