C13H21N3 — CID 103937043
6-[(1R)-1-aminopropyl]-N-(cyclopropylmethyl)-N-methylpyridin-3-amine (PubChem CID 103937043) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-[(1R)-1-aminopropyl]-N-(cyclopropylmethyl)-N-methylpyridin-3-amine.
| Compound Name | 6-[(1R)-1-aminopropyl]-N-(cyclopropylmethyl)-N-methylpyridin-3-amine |
|---|---|
| PubChem CID | 103937043 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 6-[(1R)-1-aminopropyl]-N-(cyclopropylmethyl)-N-methylpyridin-3-amine |
| SMILES | CC[C@@H](N)c1ccc(N(C)CC2CC2)cn1 |
| InChI | InChI=1S/C13H21N3/c1-3-12(14)13-7-6-11(8-15-13)16(2)9-10-4-5-10/h6-8,10,12H,3-5,9,14H2,1-2H3/t12-/m1/s1 |
| InChIKey | DLNWOZGMBKJWIS-GFCCVEGCSA-N |
| XLogP | 2.34 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |