C15H25N3 — CID 83123154
N-(cyclopropylmethyl)-N-methyl-6-[1-(propylamino)ethyl]pyridin-3-amine (PubChem CID 83123154) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-methyl-6-[1-(propylamino)ethyl]pyridin-3-amine.
| Compound Name | N-(cyclopropylmethyl)-N-methyl-6-[1-(propylamino)ethyl]pyridin-3-amine |
|---|---|
| PubChem CID | 83123154 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | N-(cyclopropylmethyl)-N-methyl-6-[1-(propylamino)ethyl]pyridin-3-amine |
| SMILES | CCCNC(C)c1ccc(N(C)CC2CC2)cn1 |
| InChI | InChI=1S/C15H25N3/c1-4-9-16-12(2)15-8-7-14(10-17-15)18(3)11-13-5-6-13/h7-8,10,12-13,16H,4-6,9,11H2,1-3H3 |
| InChIKey | GGCAILRKXQFILM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |