C16H26N4 — CID 103937123
(1R)-1-[5-[4-(cyclopropylmethyl)piperazin-1-yl]-2-pyridinyl]propan-1-amine (PubChem CID 103937123) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is (1R)-1-[5-[4-(cyclopropylmethyl)piperazin-1-yl]-2-pyridinyl]propan-1-amine.
| Compound Name | (1R)-1-[5-[4-(cyclopropylmethyl)piperazin-1-yl]-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 103937123 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | (1R)-1-[5-[4-(cyclopropylmethyl)piperazin-1-yl]-2-pyridinyl]propan-1-amine |
| SMILES | CC[C@@H](N)c1ccc(N2CCN(CC3CC3)CC2)cn1 |
| InChI | InChI=1S/C16H26N4/c1-2-15(17)16-6-5-14(11-18-16)20-9-7-19(8-10-20)12-13-3-4-13/h5-6,11,13,15H,2-4,7-10,12,17H2,1H3/t15-/m1/s1 |
| InChIKey | WQFJWTBHDLOSFK-OAHLLOKOSA-N |
| XLogP | 2.02 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |