C12H19N3OS — CID 112584315
1-[5-(1-oxo-1,4-thiazinan-4-yl)-2-pyridinyl]propan-1-amine (PubChem CID 112584315) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-[5-(1-oxo-1,4-thiazinan-4-yl)-2-pyridinyl]propan-1-amine.
| Compound Name | 1-[5-(1-oxo-1,4-thiazinan-4-yl)-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 112584315 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-[5-(1-oxo-1,4-thiazinan-4-yl)-2-pyridinyl]propan-1-amine |
| SMILES | CCC(N)c1ccc(N2CCS(=O)CC2)cn1 |
| InChI | InChI=1S/C12H19N3OS/c1-2-11(13)12-4-3-10(9-14-12)15-5-7-17(16)8-6-15/h3-4,9,11H,2,5-8,13H2,1H3 |
| InChIKey | HRMJOLJFVCZFPW-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |