C14H13F2NOS — CID 103939372
(1R)-1-[5-(3,4-difluorophenyl)sulfanyl-2-pyridinyl]propan-1-ol (PubChem CID 103939372) has the molecular formula C14H13F2NOS and a molecular weight of 281.33 g/mol. Its IUPAC name is (1R)-1-[5-(3,4-difluorophenyl)sulfanyl-2-pyridinyl]propan-1-ol.
| Compound Name | (1R)-1-[5-(3,4-difluorophenyl)sulfanyl-2-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 103939372 |
| Molecular Formula | C14H13F2NOS |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (1R)-1-[5-(3,4-difluorophenyl)sulfanyl-2-pyridinyl]propan-1-ol |
| SMILES | CC[C@@H](O)c1ccc(Sc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C14H13F2NOS/c1-2-14(18)13-6-4-10(8-17-13)19-9-3-5-11(15)12(16)7-9/h3-8,14,18H,2H2,1H3/t14-/m1/s1 |
| InChIKey | YKTJOBVWCRQCMD-CQSZACIVSA-N |
| XLogP | 3.95 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |