C29H43N3O9S — CID 10393944
(5S,7E,9E,11Z,14Z,17E)-6-[1-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-(carboxymethylamino)-2-oxoethyl]sulfanyl-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid (PubChem CID 10393944) has the molecular formula C29H43N3O9S and a molecular weight of 609.74 g/mol. Its IUPAC name is (5S,7E,9E,11Z,14Z,17E)-6-[1-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-(carboxymethylamino)-2-oxoethyl]sulfanyl-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid.
| Compound Name | (5S,7E,9E,11Z,14Z,17E)-6-[1-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-(carboxymethylamino)-2-oxoethyl]sulfanyl-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid |
|---|---|
| PubChem CID | 10393944 |
| Molecular Formula | C29H43N3O9S |
| Molecular Weight | 609.74 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | (5S,7E,9E,11Z,14Z,17E)-6-[1-[[(4S)-4-amino-4-carboxybutanoyl]amino]-2-(carboxymethylamino)-2-oxoethyl]sulfanyl-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid |
| SMILES | CC/C=C/C/C=C\C/C=C\C=C\C=C\C(SC(NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C29H43N3O9S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-23(22(33)15-14-17-25(35)36)42-28(27(39)31-20-26(37)38)32-24(34)19-18-21(30)29(40)41/h3-4,6-7,9-13,16,21-23,28,33H,2,5,8,14-15,17-20,30H2,1H3,(H,31,39)(H,32,34)(H,35,36)(H,37,38)(H,40,41)/b4-3+,7-6-,10-9-,12-11+,16-13+/t21-,22-,23?,28?/m0/s1 |
| InChIKey | QENFHQGTHYWHLL-ZJTMRWSSSA-N |
| XLogP | 2.51 |
| TPSA | 216.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|