C15H24N2O3S — CID 103942046
(1S)-1-[5-[(4,4-dimethylcyclohexyl)-methylamino]-4-nitrothiophen-2-yl]ethanol (PubChem CID 103942046) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is (1S)-1-[5-[(4,4-dimethylcyclohexyl)-methylamino]-4-nitrothiophen-2-yl]ethanol.
| Compound Name | (1S)-1-[5-[(4,4-dimethylcyclohexyl)-methylamino]-4-nitrothiophen-2-yl]ethanol |
|---|---|
| PubChem CID | 103942046 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (1S)-1-[5-[(4,4-dimethylcyclohexyl)-methylamino]-4-nitrothiophen-2-yl]ethanol |
| SMILES | C[C@H](O)c1cc([N+](=O)[O-])c(N(C)C2CCC(C)(C)CC2)s1 |
| InChI | InChI=1S/C15H24N2O3S/c1-10(18)13-9-12(17(19)20)14(21-13)16(4)11-5-7-15(2,3)8-6-11/h9-11,18H,5-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | QHJRYLJRTYWLHQ-JTQLQIEISA-N |
| XLogP | 4.11 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|