C29H30F5N3O8 — CID 10394403
(3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorobenzoyl)oxypentanoic acid (PubChem CID 10394403) has the molecular formula C29H30F5N3O8 and a molecular weight of 643.56 g/mol. Its IUPAC name is (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorobenzoyl)oxypentanoic acid.
| Compound Name | (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorobenzoyl)oxypentanoic acid |
|---|---|
| PubChem CID | 10394403 |
| Molecular Formula | C29H30F5N3O8 |
| Molecular Weight | 643.56 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | (3S)-3-[[(2S)-2-[[(2S)-3-methyl-2-(3-phenylpropanoylamino)butanoyl]amino]propanoyl]amino]-4-oxo-5-(2,3,4,5,6-pentafluorobenzoyl)oxypentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)COC(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H30F5N3O8/c1-13(2)26(37-18(39)10-9-15-7-5-4-6-8-15)28(43)35-14(3)27(42)36-16(11-19(40)41)17(38)12-45-29(44)20-21(30)23(32)25(34)24(33)22(20)31/h4-8,13-14,16,26H,9-12H2,1-3H3,(H,35,43)(H,36,42)(H,37,39)(H,40,41)/t14-,16-,26-/m0/s1 |
| InChIKey | AGOGGNOCERHACN-GSLFCAENSA-N |
| XLogP | 2.35 |
| TPSA | 167.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|