C10H17N3O2 — CID 103944808
N-(4-hydroxy-2-methylbutan-2-yl)-1-methylpyrazole-3-carboxamide (PubChem CID 103944808) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(4-hydroxy-2-methylbutan-2-yl)-1-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-hydroxy-2-methylbutan-2-yl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 103944808 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-(4-hydroxy-2-methylbutan-2-yl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)NC(C)(C)CCO)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-10(2,5-7-14)11-9(15)8-4-6-13(3)12-8/h4,6,14H,5,7H2,1-3H3,(H,11,15) |
| InChIKey | MWSIAYHOWRXDMM-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |