C16H16FNO — CID 103948018
2-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-4-fluorophenol (PubChem CID 103948018) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-4-fluorophenol.
| Compound Name | 2-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 103948018 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-[(2,3-dihydro-1H-inden-1-ylamino)methyl]-4-fluorophenol |
| SMILES | Oc1ccc(F)cc1CNC1CCc2ccccc21 |
| InChI | InChI=1S/C16H16FNO/c17-13-6-8-16(19)12(9-13)10-18-15-7-5-11-3-1-2-4-14(11)15/h1-4,6,8-9,15,18-19H,5,7,10H2 |
| InChIKey | HBPBZNVIKBRCCX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|