C14H20FNOS — CID 103948905
2-[[(3-ethylsulfanylcyclopentyl)amino]methyl]-4-fluorophenol (PubChem CID 103948905) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is 2-[[(3-ethylsulfanylcyclopentyl)amino]methyl]-4-fluorophenol.
| Compound Name | 2-[[(3-ethylsulfanylcyclopentyl)amino]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 103948905 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[[(3-ethylsulfanylcyclopentyl)amino]methyl]-4-fluorophenol |
| SMILES | CCSC1CCC(NCc2cc(F)ccc2O)C1 |
| InChI | InChI=1S/C14H20FNOS/c1-2-18-13-5-4-12(8-13)16-9-10-7-11(15)3-6-14(10)17/h3,6-7,12-13,16-17H,2,4-5,8-9H2,1H3 |
| InChIKey | WCTRNCKCAIJXSN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|