C14H19BrClNS — CID 114122903
N-[(4-bromo-2-chlorophenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine (PubChem CID 114122903) has the molecular formula C14H19BrClNS and a molecular weight of 348.74 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 114122903 |
| Molecular Formula | C14H19BrClNS |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-3-ethylsulfanylcyclopentan-1-amine |
| SMILES | CCSC1CCC(NCc2ccc(Br)cc2Cl)C1 |
| InChI | InChI=1S/C14H19BrClNS/c1-2-18-13-6-5-12(8-13)17-9-10-3-4-11(15)7-14(10)16/h3-4,7,12-13,17H,2,5-6,8-9H2,1H3 |
| InChIKey | VOHDRPMYUQPFNB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |