C14H19N3O3 — CID 103951096
2-[(4-acetylphenyl)carbamoylamino]-3-methylbutanamide (PubChem CID 103951096) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)carbamoylamino]-3-methylbutanamide.
| Compound Name | 2-[(4-acetylphenyl)carbamoylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 103951096 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[(4-acetylphenyl)carbamoylamino]-3-methylbutanamide |
| SMILES | CC(=O)c1ccc(NC(=O)NC(C(N)=O)C(C)C)cc1 |
| InChI | InChI=1S/C14H19N3O3/c1-8(2)12(13(15)19)17-14(20)16-11-6-4-10(5-7-11)9(3)18/h4-8,12H,1-3H3,(H2,15,19)(H2,16,17,20) |
| InChIKey | JXGXIHGUPFCUQF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |