C10H10N4O3 — CID 103952381
4-methyl-5-nitro-N-(1,2-oxazol-5-ylmethyl)pyridin-2-amine (PubChem CID 103952381) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-methyl-5-nitro-N-(1,2-oxazol-5-ylmethyl)pyridin-2-amine.
| Compound Name | 4-methyl-5-nitro-N-(1,2-oxazol-5-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103952381 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-methyl-5-nitro-N-(1,2-oxazol-5-ylmethyl)pyridin-2-amine |
| SMILES | Cc1cc(NCc2ccno2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O3/c1-7-4-10(12-6-9(7)14(15)16)11-5-8-2-3-13-17-8/h2-4,6H,5H2,1H3,(H,11,12) |
| InChIKey | KQPZFWXLVMIGRH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|