C11H11N3O3 — CID 113220621
4-methyl-3-nitro-N-(1,2-oxazol-5-ylmethyl)aniline (PubChem CID 113220621) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-(1,2-oxazol-5-ylmethyl)aniline.
| Compound Name | 4-methyl-3-nitro-N-(1,2-oxazol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 113220621 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-methyl-3-nitro-N-(1,2-oxazol-5-ylmethyl)aniline |
| SMILES | Cc1ccc(NCc2ccno2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11N3O3/c1-8-2-3-9(6-11(8)14(15)16)12-7-10-4-5-13-17-10/h2-6,12H,7H2,1H3 |
| InChIKey | KUZMJCWMMGVODL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|