C11H8N4O3 — CID 106417672
2-nitro-5-(1,2-oxazol-5-ylmethylamino)benzonitrile (PubChem CID 106417672) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-nitro-5-(1,2-oxazol-5-ylmethylamino)benzonitrile.
| Compound Name | 2-nitro-5-(1,2-oxazol-5-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 106417672 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 2-nitro-5-(1,2-oxazol-5-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cc(NCc2ccno2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N4O3/c12-6-8-5-9(1-2-11(8)15(16)17)13-7-10-3-4-14-18-10/h1-5,13H,7H2 |
| InChIKey | QPTLUKHJONBYTJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|