C11H10N6O2 — CID 104844266
5-[(1-methyl-1,2,4-triazol-3-yl)methylamino]-2-nitrobenzonitrile (PubChem CID 104844266) has the molecular formula C11H10N6O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is 5-[(1-methyl-1,2,4-triazol-3-yl)methylamino]-2-nitrobenzonitrile.
| Compound Name | 5-[(1-methyl-1,2,4-triazol-3-yl)methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 104844266 |
| Molecular Formula | C11H10N6O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-[(1-methyl-1,2,4-triazol-3-yl)methylamino]-2-nitrobenzonitrile |
| SMILES | Cn1cnc(CNc2ccc([N+](=O)[O-])c(C#N)c2)n1 |
| InChI | InChI=1S/C11H10N6O2/c1-16-7-14-11(15-16)6-13-9-2-3-10(17(18)19)8(4-9)5-12/h2-4,7,13H,6H2,1H3 |
| InChIKey | UAERRZHETKYENH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|