C13H16N4O2 — CID 103952914
methyl 2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoate (PubChem CID 103952914) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is methyl 2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoate.
| Compound Name | methyl 2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 103952914 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | methyl 2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C13H16N4O2/c1-9(12-15-8-16-17-12)14-7-10-5-3-4-6-11(10)13(18)19-2/h3-6,8-9,14H,7H2,1-2H3,(H,15,16,17) |
| InChIKey | NUALWGPVMJXZTG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |