C17H21NO3 — CID 103953167
4-[[(2-methyl-2-phenylpropyl)amino]methyl]benzene-1,2,3-triol (PubChem CID 103953167) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-[[(2-methyl-2-phenylpropyl)amino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[(2-methyl-2-phenylpropyl)amino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103953167 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[[(2-methyl-2-phenylpropyl)amino]methyl]benzene-1,2,3-triol |
| SMILES | CC(C)(CNCc1ccc(O)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2,13-6-4-3-5-7-13)11-18-10-12-8-9-14(19)16(21)15(12)20/h3-9,18-21H,10-11H2,1-2H3 |
| InChIKey | UNLITPRTFFSBON-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|