C16H27NO — CID 113350453
3,3-dimethyl-1-[(2-methyl-2-phenylpropyl)amino]butan-2-ol (PubChem CID 113350453) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2-methyl-2-phenylpropyl)amino]butan-2-ol.
| Compound Name | 3,3-dimethyl-1-[(2-methyl-2-phenylpropyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 113350453 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 3,3-dimethyl-1-[(2-methyl-2-phenylpropyl)amino]butan-2-ol |
| SMILES | CC(C)(CNCC(O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H27NO/c1-15(2,3)14(18)11-17-12-16(4,5)13-9-7-6-8-10-13/h6-10,14,17-18H,11-12H2,1-5H3 |
| InChIKey | WDLRJTYXHNKEAD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |