C16H27NO2 — CID 107151998
1-[(2-hydroxy-2-phenylpropyl)amino]-4,4-dimethylpentan-2-ol (PubChem CID 107151998) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 1-[(2-hydroxy-2-phenylpropyl)amino]-4,4-dimethylpentan-2-ol.
| Compound Name | 1-[(2-hydroxy-2-phenylpropyl)amino]-4,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 107151998 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 1-[(2-hydroxy-2-phenylpropyl)amino]-4,4-dimethylpentan-2-ol |
| SMILES | CC(C)(C)CC(O)CNCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C16H27NO2/c1-15(2,3)10-14(18)11-17-12-16(4,19)13-8-6-5-7-9-13/h5-9,14,17-19H,10-12H2,1-4H3 |
| InChIKey | HYAXMJVEHWPDDP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |