C13H16N2O3S — CID 103953541
4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]benzene-1,2,3-triol (PubChem CID 103953541) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]benzene-1,2,3-triol.
| Compound Name | 4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 103953541 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 4-[[1-(1,3-thiazol-2-yl)propylamino]methyl]benzene-1,2,3-triol |
| SMILES | CCC(NCc1ccc(O)c(O)c1O)c1nccs1 |
| InChI | InChI=1S/C13H16N2O3S/c1-2-9(13-14-5-6-19-13)15-7-8-3-4-10(16)12(18)11(8)17/h3-6,9,15-18H,2,7H2,1H3 |
| InChIKey | TYPSDGWVCFGQQF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|