C9H12ClNS — CID 103954023
5-(5-chloro-2-methylpent-2-enyl)-1,3-thiazole (PubChem CID 103954023) has the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. Its IUPAC name is 5-(5-chloro-2-methylpent-2-enyl)-1,3-thiazole.
| Compound Name | 5-(5-chloro-2-methylpent-2-enyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103954023 |
| Molecular Formula | C9H12ClNS |
| Molecular Weight | 201.72 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 5-(5-chloro-2-methylpent-2-enyl)-1,3-thiazole |
| SMILES | CC(=CCCCl)Cc1cncs1 |
| InChI | InChI=1S/C9H12ClNS/c1-8(3-2-4-10)5-9-6-11-7-12-9/h3,6-7H,2,4-5H2,1H3 |
| InChIKey | NXIRPGXPKGXBLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.72 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|