C13H17NO5 — CID 103957951
methyl 2-hydroxy-3-[(2-phenylmethoxyacetyl)amino]propanoate (PubChem CID 103957951) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(2-phenylmethoxyacetyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(2-phenylmethoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 103957951 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | methyl 2-hydroxy-3-[(2-phenylmethoxyacetyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C13H17NO5/c1-18-13(17)11(15)7-14-12(16)9-19-8-10-5-3-2-4-6-10/h2-6,11,15H,7-9H2,1H3,(H,14,16) |
| InChIKey | HVFMRQLYTWMHDR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |