C13H15NO3S2 — CID 54510492
methyl 2-hydroxy-3-[(3-phenyl-2-sulfanylidenepropanethioyl)amino]propanoate (PubChem CID 54510492) has the molecular formula C13H15NO3S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(3-phenyl-2-sulfanylidenepropanethioyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(3-phenyl-2-sulfanylidenepropanethioyl)amino]propanoate |
|---|---|
| PubChem CID | 54510492 |
| Molecular Formula | C13H15NO3S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | methyl 2-hydroxy-3-[(3-phenyl-2-sulfanylidenepropanethioyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=S)C(=S)Cc1ccccc1 |
| InChI | InChI=1S/C13H15NO3S2/c1-17-13(16)10(15)8-14-12(19)11(18)7-9-5-3-2-4-6-9/h2-6,10,15H,7-8H2,1H3,(H,14,19) |
| InChIKey | YITKCMJSPPMQCW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|