C10H14F2N4O — CID 103958277
3-[(3,5-difluoro-2-pyridinyl)-methylamino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 103958277) has the molecular formula C10H14F2N4O and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[(3,5-difluoro-2-pyridinyl)-methylamino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[(3,5-difluoro-2-pyridinyl)-methylamino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 103958277 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-[(3,5-difluoro-2-pyridinyl)-methylamino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CC(CN(C)c1ncc(F)cc1F)C(N)=NO |
| InChI | InChI=1S/C10H14F2N4O/c1-6(9(13)15-17)5-16(2)10-8(12)3-7(11)4-14-10/h3-4,6,17H,5H2,1-2H3,(H2,13,15) |
| InChIKey | WGVUBKAQRNFYHK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|