C12H18F2N4O — CID 103958279
3-[(3,5-difluoro-2-pyridinyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide (PubChem CID 103958279) has the molecular formula C12H18F2N4O and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[(3,5-difluoro-2-pyridinyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(3,5-difluoro-2-pyridinyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103958279 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-[(3,5-difluoro-2-pyridinyl)-(2-methylpropyl)amino]-N'-hydroxypropanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)c1ncc(F)cc1F |
| InChI | InChI=1S/C12H18F2N4O/c1-8(2)7-18(4-3-11(15)17-19)12-10(14)5-9(13)6-16-12/h5-6,8,19H,3-4,7H2,1-2H3,(H2,15,17) |
| InChIKey | VVNBUYWYQKTJLS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|