C15H26N2O — CID 103959097
2-[(1R)-1-aminopropyl]-N-(2-methoxyethyl)-N-propan-2-ylaniline (PubChem CID 103959097) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-[(1R)-1-aminopropyl]-N-(2-methoxyethyl)-N-propan-2-ylaniline.
| Compound Name | 2-[(1R)-1-aminopropyl]-N-(2-methoxyethyl)-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 103959097 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-[(1R)-1-aminopropyl]-N-(2-methoxyethyl)-N-propan-2-ylaniline |
| SMILES | CC[C@@H](N)c1ccccc1N(CCOC)C(C)C |
| InChI | InChI=1S/C15H26N2O/c1-5-14(16)13-8-6-7-9-15(13)17(12(2)3)10-11-18-4/h6-9,12,14H,5,10-11,16H2,1-4H3/t14-/m1/s1 |
| InChIKey | SRMDXYZDZQFHHU-CQSZACIVSA-N |
| XLogP | 2.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |