C16H15FN2O — CID 103960910
2-[3-[(5-fluoro-2-methylphenyl)methylamino]phenoxy]acetonitrile (PubChem CID 103960910) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is 2-[3-[(5-fluoro-2-methylphenyl)methylamino]phenoxy]acetonitrile.
| Compound Name | 2-[3-[(5-fluoro-2-methylphenyl)methylamino]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 103960910 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[3-[(5-fluoro-2-methylphenyl)methylamino]phenoxy]acetonitrile |
| SMILES | Cc1ccc(F)cc1CNc1cccc(OCC#N)c1 |
| InChI | InChI=1S/C16H15FN2O/c1-12-5-6-14(17)9-13(12)11-19-15-3-2-4-16(10-15)20-8-7-18/h2-6,9-10,19H,8,11H2,1H3 |
| InChIKey | ZILJHKVCLDHJQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |