C12H14INO5S — CID 103962332
2-iodo-5-(oxan-4-ylsulfamoyl)benzoic acid (PubChem CID 103962332) has the molecular formula C12H14INO5S and a molecular weight of 411.22 g/mol. Its IUPAC name is 2-iodo-5-(oxan-4-ylsulfamoyl)benzoic acid.
| Compound Name | 2-iodo-5-(oxan-4-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 103962332 |
| Molecular Formula | C12H14INO5S |
| Molecular Weight | 411.22 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | 2-iodo-5-(oxan-4-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2CCOCC2)ccc1I |
| InChI | InChI=1S/C12H14INO5S/c13-11-2-1-9(7-10(11)12(15)16)20(17,18)14-8-3-5-19-6-4-8/h1-2,7-8,14H,3-6H2,(H,15,16) |
| InChIKey | OFBOUFNHTQDXFP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|