C16H30N2OS — CID 103966863
2-carbamothioyl-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide (PubChem CID 103966863) has the molecular formula C16H30N2OS and a molecular weight of 298.50 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 103966863 |
| Molecular Formula | C16H30N2OS |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide |
| SMILES | CC(C)C(C(=O)NC1CC(C)(C)CC(C)(C)C1)C(N)=S |
| InChI | InChI=1S/C16H30N2OS/c1-10(2)12(13(17)20)14(19)18-11-7-15(3,4)9-16(5,6)8-11/h10-12H,7-9H2,1-6H3,(H2,17,20)(H,18,19) |
| InChIKey | BUPURGLDYVZWTD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|