C15H29NOS — CID 107034259
3-methyl-2-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide (PubChem CID 107034259) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is 3-methyl-2-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide.
| Compound Name | 3-methyl-2-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 107034259 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 3-methyl-2-sulfanyl-N-(3,3,5,5-tetramethylcyclohexyl)butanamide |
| SMILES | CC(C)C(S)C(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H29NOS/c1-10(2)12(18)13(17)16-11-7-14(3,4)9-15(5,6)8-11/h10-12,18H,7-9H2,1-6H3,(H,16,17) |
| InChIKey | LYCBBRWSGICDDY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|