C10H19NOS — CID 107035168
3-methyl-N-(3-methylcyclobutyl)-2-sulfanylbutanamide (PubChem CID 107035168) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 3-methyl-N-(3-methylcyclobutyl)-2-sulfanylbutanamide.
| Compound Name | 3-methyl-N-(3-methylcyclobutyl)-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107035168 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 3-methyl-N-(3-methylcyclobutyl)-2-sulfanylbutanamide |
| SMILES | CC1CC(NC(=O)C(S)C(C)C)C1 |
| InChI | InChI=1S/C10H19NOS/c1-6(2)9(13)10(12)11-8-4-7(3)5-8/h6-9,13H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | JJGUJDPHZFUHPV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|