C16H26ClN3O — CID 103969249
N-[[1-(chloromethyl)cyclohexyl]methyl]-4-methyl-6-propan-2-yloxypyrimidin-2-amine (PubChem CID 103969249) has the molecular formula C16H26ClN3O and a molecular weight of 311.86 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]-4-methyl-6-propan-2-yloxypyrimidin-2-amine.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-4-methyl-6-propan-2-yloxypyrimidin-2-amine |
|---|---|
| PubChem CID | 103969249 |
| Molecular Formula | C16H26ClN3O |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-4-methyl-6-propan-2-yloxypyrimidin-2-amine |
| SMILES | Cc1cc(OC(C)C)nc(NCC2(CCl)CCCCC2)n1 |
| InChI | InChI=1S/C16H26ClN3O/c1-12(2)21-14-9-13(3)19-15(20-14)18-11-16(10-17)7-5-4-6-8-16/h9,12H,4-8,10-11H2,1-3H3,(H,18,19,20) |
| InChIKey | BBXYDQCJCJQREW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|