C13H21ClN4 — CID 114787922
N-[[1-(chloromethyl)cyclohexyl]methyl]-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 114787922) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 114787922 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCC2(CCl)CCCCC2)nc1C |
| InChI | InChI=1S/C13H21ClN4/c1-10-11(2)17-18-12(16-10)15-9-13(8-14)6-4-3-5-7-13/h3-9H2,1-2H3,(H,15,16,18) |
| InChIKey | HKPSDNDRLHMYRZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|