C24H22N4O3S — CID 1039693
4-methyl-N-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]benzenesulfonamide (PubChem CID 1039693) has the molecular formula C24H22N4O3S and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-methyl-N-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]benzenesulfonamide.
| Compound Name | 4-methyl-N-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 1039693 |
| Molecular Formula | C24H22N4O3S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 4-methyl-N-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C(c2ccccc2)c2c(C)[nH]n(-c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C24H22N4O3S/c1-17-13-15-21(16-14-17)32(30,31)27-25-23(19-9-5-3-6-10-19)22-18(2)26-28(24(22)29)20-11-7-4-8-12-20/h3-16,26-27H,1-2H3 |
| InChIKey | IQDUVTYHQOFSPL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|