C36H32N6O2 — CID 3641993
5-methyl-4-[N-[2-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]ethyl]-C-phenylcarbonimidoyl]-2-phenyl-1H-pyrazol-3-one (PubChem CID 3641993) has the molecular formula C36H32N6O2 and a molecular weight of 580.69 g/mol. Its IUPAC name is 5-methyl-4-[N-[2-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]ethyl]-C-phenylcarbonimidoyl]-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 5-methyl-4-[N-[2-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]ethyl]-C-phenylcarbonimidoyl]-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3641993 |
| Molecular Formula | C36H32N6O2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 5-methyl-4-[N-[2-[[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-phenylmethylidene]amino]ethyl]-C-phenylcarbonimidoyl]-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C(=N/CC/N=C(\c1ccccc1)c1c(C)[nH]n(-c2ccccc2)c1=O)c1ccccc1 |
| InChI | InChI=1S/C36H32N6O2/c1-25-31(35(43)41(39-25)29-19-11-5-12-20-29)33(27-15-7-3-8-16-27)37-23-24-38-34(28-17-9-4-10-18-28)32-26(2)40-42(36(32)44)30-21-13-6-14-22-30/h3-22,39-40H,23-24H2,1-2H3/b37-33+,38-34+ |
| InChIKey | SHSKRSPOPXPEFZ-YEQLPCBTSA-N |
| XLogP | 5.64 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|