C29H24N4OS2 — CID 137124050
4-[N-[2-[(2-aminophenyl)disulfanyl]phenyl]-C-phenylcarbonimidoyl]-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 137124050) has the molecular formula C29H24N4OS2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 4-[N-[2-[(2-aminophenyl)disulfanyl]phenyl]-C-phenylcarbonimidoyl]-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-[N-[2-[(2-aminophenyl)disulfanyl]phenyl]-C-phenylcarbonimidoyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137124050 |
| Molecular Formula | C29H24N4OS2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 4-[N-[2-[(2-aminophenyl)disulfanyl]phenyl]-C-phenylcarbonimidoyl]-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C(=N/c1ccccc1SSc1ccccc1N)c1ccccc1 |
| InChI | InChI=1S/C29H24N4OS2/c1-20-27(29(34)33(32-20)22-14-6-3-7-15-22)28(21-12-4-2-5-13-21)31-24-17-9-11-19-26(24)36-35-25-18-10-8-16-23(25)30/h2-19,32H,30H2,1H3/b31-28+ |
| InChIKey | BXXJMQKWLZCCEN-CCFHIKDMSA-N |
| XLogP | 7.02 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|