C13H14N2OS2 — CID 2738114
ethyl 5-methyl-3-oxo-2-phenyl-1H-pyrazole-4-carbodithioate (PubChem CID 2738114) has the molecular formula C13H14N2OS2 and a molecular weight of 278.40 g/mol. Its IUPAC name is ethyl 5-methyl-3-oxo-2-phenyl-1H-pyrazole-4-carbodithioate.
| Compound Name | ethyl 5-methyl-3-oxo-2-phenyl-1H-pyrazole-4-carbodithioate |
|---|---|
| PubChem CID | 2738114 |
| Molecular Formula | C13H14N2OS2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | ethyl 5-methyl-3-oxo-2-phenyl-1H-pyrazole-4-carbodithioate |
| SMILES | CCSC(=S)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C13H14N2OS2/c1-3-18-13(17)11-9(2)14-15(12(11)16)10-7-5-4-6-8-10/h4-8,14H,3H2,1-2H3 |
| InChIKey | UPZXMPDCUZWYFZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ester_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|