C13H17ClINOS — CID 103969561
N-[[1-(chloromethyl)cyclohexyl]methyl]-5-iodothiophene-3-carboxamide (PubChem CID 103969561) has the molecular formula C13H17ClINOS and a molecular weight of 397.71 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]-5-iodothiophene-3-carboxamide.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 103969561 |
| Molecular Formula | C13H17ClINOS |
| Molecular Weight | 397.71 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-5-iodothiophene-3-carboxamide |
| SMILES | O=C(NCC1(CCl)CCCCC1)c1csc(I)c1 |
| InChI | InChI=1S/C13H17ClINOS/c14-8-13(4-2-1-3-5-13)9-16-12(17)10-6-11(15)18-7-10/h6-7H,1-5,8-9H2,(H,16,17) |
| InChIKey | JEDDLABMNJJKSQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|