C13H18ClN3O — CID 104672791
N-[[1-(chloromethyl)cyclohexyl]methyl]pyridazine-4-carboxamide (PubChem CID 104672791) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 104672791 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NCC1(CCl)CCCCC1)c1ccnnc1 |
| InChI | InChI=1S/C13H18ClN3O/c14-9-13(5-2-1-3-6-13)10-15-12(18)11-4-7-16-17-8-11/h4,7-8H,1-3,5-6,9-10H2,(H,15,18) |
| InChIKey | AJKSJHOSADAQRB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|