C14H18Cl2N2O — CID 113359928
3-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]pyridine-4-carboxamide (PubChem CID 113359928) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 3-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 113359928 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 3-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(NCC1(CCl)CCCCC1)c1ccncc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c15-9-14(5-2-1-3-6-14)10-18-13(19)11-4-7-17-8-12(11)16/h4,7-8H,1-3,5-6,9-10H2,(H,18,19) |
| InChIKey | NIKIEBUKWJHAHW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|