C13H17Cl2NO2 — CID 106690116
2-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]furan-3-carboxamide (PubChem CID 106690116) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is 2-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106690116 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 2-chloro-N-[[1-(chloromethyl)cyclohexyl]methyl]furan-3-carboxamide |
| SMILES | O=C(NCC1(CCl)CCCCC1)c1ccoc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c14-8-13(5-2-1-3-6-13)9-16-12(17)10-4-7-18-11(10)15/h4,7H,1-3,5-6,8-9H2,(H,16,17) |
| InChIKey | HIESGXNUSLOWMN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|