C15H24ClN3OS — CID 103969563
4-tert-butyl-N-[[1-(chloromethyl)cyclohexyl]methyl]thiadiazole-5-carboxamide (PubChem CID 103969563) has the molecular formula C15H24ClN3OS and a molecular weight of 329.90 g/mol. Its IUPAC name is 4-tert-butyl-N-[[1-(chloromethyl)cyclohexyl]methyl]thiadiazole-5-carboxamide.
| Compound Name | 4-tert-butyl-N-[[1-(chloromethyl)cyclohexyl]methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 103969563 |
| Molecular Formula | C15H24ClN3OS |
| Molecular Weight | 329.90 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 4-tert-butyl-N-[[1-(chloromethyl)cyclohexyl]methyl]thiadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1nnsc1C(=O)NCC1(CCl)CCCCC1 |
| InChI | InChI=1S/C15H24ClN3OS/c1-14(2,3)12-11(21-19-18-12)13(20)17-10-15(9-16)7-5-4-6-8-15/h4-10H2,1-3H3,(H,17,20) |
| InChIKey | RYBHZAUFIQNEEX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.90 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|