C9H12O2 — CID 10397001
(1S,5S)-1,3,4,5-tetramethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one (PubChem CID 10397001) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1S,5S)-1,3,4,5-tetramethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one.
| Compound Name | (1S,5S)-1,3,4,5-tetramethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
|---|---|
| PubChem CID | 10397001 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1S,5S)-1,3,4,5-tetramethyl-6-oxabicyclo[3.1.0]hex-3-en-2-one |
| SMILES | CC1=C(C)[C@]2(C)O[C@]2(C)C1=O |
| InChI | InChI=1S/C9H12O2/c1-5-6(2)8(3)9(4,11-8)7(5)10/h1-4H3/t8-,9+/m0/s1 |
| InChIKey | YLSIHLXJMZJSRV-DTWKUNHWSA-N |
| XLogP | 1.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|