C33H20N2O7 — CID 1039702
2-(3-acetylphenyl)-5-[2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione (PubChem CID 1039702) has the molecular formula C33H20N2O7 and a molecular weight of 556.53 g/mol. Its IUPAC name is 2-(3-acetylphenyl)-5-[2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-(3-acetylphenyl)-5-[2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1039702 |
| Molecular Formula | C33H20N2O7 |
| Molecular Weight | 556.53 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-(3-acetylphenyl)-5-[2-(3-acetylphenyl)-1,3-dioxoisoindole-5-carbonyl]isoindole-1,3-dione |
| SMILES | CC(=O)c1cccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4cccc(C(C)=O)c4)C5=O)cc3C2=O)c1 |
| InChI | InChI=1S/C33H20N2O7/c1-17(36)19-5-3-7-23(13-19)34-30(39)25-11-9-21(15-27(25)32(34)41)29(38)22-10-12-26-28(16-22)33(42)35(31(26)40)24-8-4-6-20(14-24)18(2)37/h3-16H,1-2H3 |
| InChIKey | WHYAEFHSCZAAMA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 125.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|