C12H19F3O4 — CID 103972845
diethyl 2-propyl-2-(2,2,2-trifluoroethyl)propanedioate (PubChem CID 103972845) has the molecular formula C12H19F3O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is diethyl 2-propyl-2-(2,2,2-trifluoroethyl)propanedioate.
| Compound Name | diethyl 2-propyl-2-(2,2,2-trifluoroethyl)propanedioate |
|---|---|
| PubChem CID | 103972845 |
| Molecular Formula | C12H19F3O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | diethyl 2-propyl-2-(2,2,2-trifluoroethyl)propanedioate |
| SMILES | CCCC(CC(F)(F)F)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C12H19F3O4/c1-4-7-11(8-12(13,14)15,9(16)18-5-2)10(17)19-6-3/h4-8H2,1-3H3 |
| InChIKey | QQAFZBKDJRLVDS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|