C10H16F2O4 — CID 103974069
2-(2,2-difluoroethyl)-2-ethoxycarbonylpentanoic acid (PubChem CID 103974069) has the molecular formula C10H16F2O4 and a molecular weight of 238.23 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-2-ethoxycarbonylpentanoic acid.
| Compound Name | 2-(2,2-difluoroethyl)-2-ethoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 103974069 |
| Molecular Formula | C10H16F2O4 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-(2,2-difluoroethyl)-2-ethoxycarbonylpentanoic acid |
| SMILES | CCCC(CC(F)F)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C10H16F2O4/c1-3-5-10(8(13)14,6-7(11)12)9(15)16-4-2/h7H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | FEDHJNSAKWGZFT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|