C12H17F3O4 — CID 103974632
2-cyclopentyl-5,5,5-trifluoro-2-methoxycarbonylpentanoic acid (PubChem CID 103974632) has the molecular formula C12H17F3O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-cyclopentyl-5,5,5-trifluoro-2-methoxycarbonylpentanoic acid.
| Compound Name | 2-cyclopentyl-5,5,5-trifluoro-2-methoxycarbonylpentanoic acid |
|---|---|
| PubChem CID | 103974632 |
| Molecular Formula | C12H17F3O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-cyclopentyl-5,5,5-trifluoro-2-methoxycarbonylpentanoic acid |
| SMILES | COC(=O)C(CCC(F)(F)F)(C(=O)O)C1CCCC1 |
| InChI | InChI=1S/C12H17F3O4/c1-19-10(18)11(9(16)17,6-7-12(13,14)15)8-4-2-3-5-8/h8H,2-7H2,1H3,(H,16,17) |
| InChIKey | HJVJKENKNAHXEJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|